C12H7F9O3 — CID 143972026
(2,2,3,3-tetrafluoro-4-methoxybutyl) 2,3,4,5,6-pentafluorobenzoate (PubChem CID 143972026) has the molecular formula C12H7F9O3 and a molecular weight of 370.17 g/mol. Its IUPAC name is (2,2,3,3-tetrafluoro-4-methoxybutyl) 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | (2,2,3,3-tetrafluoro-4-methoxybutyl) 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 143972026 |
| Molecular Formula | C12H7F9O3 |
| Molecular Weight | 370.17 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | (2,2,3,3-tetrafluoro-4-methoxybutyl) 2,3,4,5,6-pentafluorobenzoate |
| SMILES | COCC(F)(F)C(F)(F)COC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H7F9O3/c1-23-2-11(18,19)12(20,21)3-24-10(22)4-5(13)7(15)9(17)8(16)6(4)14/h2-3H2,1H3 |
| InChIKey | GSQJJZYZYCDQPU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.17 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|