C19H10F8I2O4 — CID 101495540
[2,2-dimethyl-3-(2,3,4,5-tetrafluoro-6-iodobenzoyl)oxypropyl] 2,3,4,5-tetrafluoro-6-iodobenzoate (PubChem CID 101495540) has the molecular formula C19H10F8I2O4 and a molecular weight of 708.08 g/mol. Its IUPAC name is [2,2-dimethyl-3-(2,3,4,5-tetrafluoro-6-iodobenzoyl)oxypropyl] 2,3,4,5-tetrafluoro-6-iodobenzoate.
| Compound Name | [2,2-dimethyl-3-(2,3,4,5-tetrafluoro-6-iodobenzoyl)oxypropyl] 2,3,4,5-tetrafluoro-6-iodobenzoate |
|---|---|
| PubChem CID | 101495540 |
| Molecular Formula | C19H10F8I2O4 |
| Molecular Weight | 708.08 g/mol |
| Exact Mass | 707.85 |
| IUPAC Name | [2,2-dimethyl-3-(2,3,4,5-tetrafluoro-6-iodobenzoyl)oxypropyl] 2,3,4,5-tetrafluoro-6-iodobenzoate |
| SMILES | CC(C)(COC(=O)c1c(F)c(F)c(F)c(F)c1I)COC(=O)c1c(F)c(F)c(F)c(F)c1I |
| InChI | InChI=1S/C19H10F8I2O4/c1-19(2,3-32-17(30)5-7(20)9(22)11(24)13(26)15(5)28)4-33-18(31)6-8(21)10(23)12(25)14(27)16(6)29/h3-4H2,1-2H3 |
| InChIKey | ZPSHDNYCXUJVDV-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.08 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|