C13H10F4N4O3 — CID 155383085
2-(2-methylprop-2-enoylamino)ethyl 4-azido-2,3,5,6-tetrafluorobenzoate (PubChem CID 155383085) has the molecular formula C13H10F4N4O3 and a molecular weight of 346.24 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoylamino)ethyl 4-azido-2,3,5,6-tetrafluorobenzoate.
| Compound Name | 2-(2-methylprop-2-enoylamino)ethyl 4-azido-2,3,5,6-tetrafluorobenzoate |
|---|---|
| PubChem CID | 155383085 |
| Molecular Formula | C13H10F4N4O3 |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 2-(2-methylprop-2-enoylamino)ethyl 4-azido-2,3,5,6-tetrafluorobenzoate |
| SMILES | C=C(C)C(=O)NCCOC(=O)c1c(F)c(F)c(N=[N+]=[N-])c(F)c1F |
| InChI | InChI=1S/C13H10F4N4O3/c1-5(2)12(22)19-3-4-24-13(23)6-7(14)9(16)11(20-21-18)10(17)8(6)15/h1,3-4H2,2H3,(H,19,22) |
| InChIKey | JFNUMAKBKBOAHH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|