C12H13F4N5O — CID 101443600
4-azido-N-[3-(dimethylamino)propyl]-2,3,5,6-tetrafluorobenzamide (PubChem CID 101443600) has the molecular formula C12H13F4N5O and a molecular weight of 319.26 g/mol. Its IUPAC name is 4-azido-N-[3-(dimethylamino)propyl]-2,3,5,6-tetrafluorobenzamide.
| Compound Name | 4-azido-N-[3-(dimethylamino)propyl]-2,3,5,6-tetrafluorobenzamide |
|---|---|
| PubChem CID | 101443600 |
| Molecular Formula | C12H13F4N5O |
| Molecular Weight | 319.26 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 4-azido-N-[3-(dimethylamino)propyl]-2,3,5,6-tetrafluorobenzamide |
| SMILES | CN(C)CCCNC(=O)c1c(F)c(F)c(N=[N+]=[N-])c(F)c1F |
| InChI | InChI=1S/C12H13F4N5O/c1-21(2)5-3-4-18-12(22)6-7(13)9(15)11(19-20-17)10(16)8(6)14/h3-5H2,1-2H3,(H,18,22) |
| InChIKey | XOVFNJAYOSQUIS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|