C32H23F4N7O2 — CID 132518930
4-azido-N-[4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenoxy]butyl]-2,3,5,6-tetrafluorobenzamide (PubChem CID 132518930) has the molecular formula C32H23F4N7O2 and a molecular weight of 613.58 g/mol. Its IUPAC name is 4-azido-N-[4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenoxy]butyl]-2,3,5,6-tetrafluorobenzamide.
| Compound Name | 4-azido-N-[4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenoxy]butyl]-2,3,5,6-tetrafluorobenzamide |
|---|---|
| PubChem CID | 132518930 |
| Molecular Formula | C32H23F4N7O2 |
| Molecular Weight | 613.58 g/mol |
| Exact Mass | 613.18 |
| IUPAC Name | 4-azido-N-[4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenoxy]butyl]-2,3,5,6-tetrafluorobenzamide |
| SMILES | [N-]=[N+]=Nc1c(F)c(F)c(C(=O)NCCCCOc2ccc(-c3cc(-c4ccccn4)nc(-c4ccccn4)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C32H23F4N7O2/c33-27-26(28(34)30(36)31(29(27)35)42-43-37)32(44)40-15-5-6-16-45-21-11-9-19(10-12-21)20-17-24(22-7-1-3-13-38-22)41-25(18-20)23-8-2-4-14-39-23/h1-4,7-14,17-18H,5-6,15-16H2,(H,40,44) |
| InChIKey | NJHGUJCDZRDGGE-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.58 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|