C11H12F4N4O4Si — CID 59753258
4-azido-2,3,5,6-tetrafluoro-N-(trimethoxysilylmethyl)benzamide (PubChem CID 59753258) has the molecular formula C11H12F4N4O4Si and a molecular weight of 368.32 g/mol. Its IUPAC name is 4-azido-2,3,5,6-tetrafluoro-N-(trimethoxysilylmethyl)benzamide.
| Compound Name | 4-azido-2,3,5,6-tetrafluoro-N-(trimethoxysilylmethyl)benzamide |
|---|---|
| PubChem CID | 59753258 |
| Molecular Formula | C11H12F4N4O4Si |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 4-azido-2,3,5,6-tetrafluoro-N-(trimethoxysilylmethyl)benzamide |
| SMILES | CO[Si](CNC(=O)c1c(F)c(F)c(N=[N+]=[N-])c(F)c1F)(OC)OC |
| InChI | InChI=1S/C11H12F4N4O4Si/c1-21-24(22-2,23-3)4-17-11(20)5-6(12)8(14)10(18-19-16)9(15)7(5)13/h4H2,1-3H3,(H,17,20) |
| InChIKey | UPCVWECVTPOQSQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|