C15H18F4N4O2 — CID 59172552
4-azido-2,3,5,6-tetrafluoro-N-(8-hydroxyoctyl)benzamide (PubChem CID 59172552) has the molecular formula C15H18F4N4O2 and a molecular weight of 362.33 g/mol. Its IUPAC name is 4-azido-2,3,5,6-tetrafluoro-N-(8-hydroxyoctyl)benzamide.
| Compound Name | 4-azido-2,3,5,6-tetrafluoro-N-(8-hydroxyoctyl)benzamide |
|---|---|
| PubChem CID | 59172552 |
| Molecular Formula | C15H18F4N4O2 |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 4-azido-2,3,5,6-tetrafluoro-N-(8-hydroxyoctyl)benzamide |
| SMILES | [N-]=[N+]=Nc1c(F)c(F)c(C(=O)NCCCCCCCCO)c(F)c1F |
| InChI | InChI=1S/C15H18F4N4O2/c16-10-9(11(17)13(19)14(12(10)18)22-23-20)15(25)21-7-5-3-1-2-4-6-8-24/h24H,1-8H2,(H,21,25) |
| InChIKey | NARYVDMWLRXRLN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 98.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|