C12H11F4N5O3S — CID 155381882
4-azido-N-[3-(ethenylsulfonylamino)propyl]-2,3,5,6-tetrafluorobenzamide (PubChem CID 155381882) has the molecular formula C12H11F4N5O3S and a molecular weight of 381.31 g/mol. Its IUPAC name is 4-azido-N-[3-(ethenylsulfonylamino)propyl]-2,3,5,6-tetrafluorobenzamide.
| Compound Name | 4-azido-N-[3-(ethenylsulfonylamino)propyl]-2,3,5,6-tetrafluorobenzamide |
|---|---|
| PubChem CID | 155381882 |
| Molecular Formula | C12H11F4N5O3S |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 4-azido-N-[3-(ethenylsulfonylamino)propyl]-2,3,5,6-tetrafluorobenzamide |
| SMILES | C=CS(=O)(=O)NCCCNC(=O)c1c(F)c(F)c(N=[N+]=[N-])c(F)c1F |
| InChI | InChI=1S/C12H11F4N5O3S/c1-2-25(23,24)19-5-3-4-18-12(22)6-7(13)9(15)11(20-21-17)10(16)8(6)14/h2,19H,1,3-5H2,(H,18,22) |
| InChIKey | IPYSURDYHBCXHU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 124.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|