C12H10F4N4O4S — CID 155381857
3-(prop-2-enoylamino)propyl 4-azido-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 155381857) has the molecular formula C12H10F4N4O4S and a molecular weight of 382.30 g/mol. Its IUPAC name is 3-(prop-2-enoylamino)propyl 4-azido-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | 3-(prop-2-enoylamino)propyl 4-azido-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 155381857 |
| Molecular Formula | C12H10F4N4O4S |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 3-(prop-2-enoylamino)propyl 4-azido-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | C=CC(=O)NCCCOS(=O)(=O)c1c(F)c(F)c(N=[N+]=[N-])c(F)c1F |
| InChI | InChI=1S/C12H10F4N4O4S/c1-2-6(21)18-4-3-5-24-25(22,23)12-9(15)7(13)11(19-20-17)8(14)10(12)16/h2H,1,3-5H2,(H,18,21) |
| InChIKey | HKGJZRRODPNTIB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 121.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|