C8H6F4N4O5S2 — CID 134574983
2-[(4-azido-2,3,5,6-tetrafluorophenyl)sulfonylamino]ethanesulfonic acid (PubChem CID 134574983) has the molecular formula C8H6F4N4O5S2 and a molecular weight of 378.29 g/mol. Its IUPAC name is 2-[(4-azido-2,3,5,6-tetrafluorophenyl)sulfonylamino]ethanesulfonic acid.
| Compound Name | 2-[(4-azido-2,3,5,6-tetrafluorophenyl)sulfonylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 134574983 |
| Molecular Formula | C8H6F4N4O5S2 |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | 2-[(4-azido-2,3,5,6-tetrafluorophenyl)sulfonylamino]ethanesulfonic acid |
| SMILES | [N-]=[N+]=Nc1c(F)c(F)c(S(=O)(=O)NCCS(=O)(=O)O)c(F)c1F |
| InChI | InChI=1S/C8H6F4N4O5S2/c9-3-5(11)8(6(12)4(10)7(3)15-16-13)23(20,21)14-1-2-22(17,18)19/h14H,1-2H2,(H,17,18,19) |
| InChIKey | IKXDWMRPECMABW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 149.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|