C10H11F5N2O2S — CID 118636668
N-[2-(dimethylamino)ethyl]-2,3,4,5,6-pentafluorobenzenesulfonamide (PubChem CID 118636668) has the molecular formula C10H11F5N2O2S and a molecular weight of 318.27 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2,3,4,5,6-pentafluorobenzenesulfonamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2,3,4,5,6-pentafluorobenzenesulfonamide |
|---|---|
| PubChem CID | 118636668 |
| Molecular Formula | C10H11F5N2O2S |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2,3,4,5,6-pentafluorobenzenesulfonamide |
| SMILES | CN(C)CCNS(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H11F5N2O2S/c1-17(2)4-3-16-20(18,19)10-8(14)6(12)5(11)7(13)9(10)15/h16H,3-4H2,1-2H3 |
| InChIKey | XTUPNWLQVKZMFB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|