C16H28N2O2S — CID 2804483
N-[3-(dimethylamino)propyl]-2,3,4,5,6-pentamethylbenzenesulfonamide (PubChem CID 2804483) has the molecular formula C16H28N2O2S and a molecular weight of 312.48 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2,3,4,5,6-pentamethylbenzenesulfonamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2,3,4,5,6-pentamethylbenzenesulfonamide |
|---|---|
| PubChem CID | 2804483 |
| Molecular Formula | C16H28N2O2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2,3,4,5,6-pentamethylbenzenesulfonamide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)NCCCN(C)C)c(C)c1C |
| InChI | InChI=1S/C16H28N2O2S/c1-11-12(2)14(4)16(15(5)13(11)3)21(19,20)17-9-8-10-18(6)7/h17H,8-10H2,1-7H3 |
| InChIKey | YNCKKUWFCDROGM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|