C15H26N2O2S — CID 120583696
N-(4-aminobutyl)-2,3,4,5,6-pentamethylbenzenesulfonamide (PubChem CID 120583696) has the molecular formula C15H26N2O2S and a molecular weight of 298.45 g/mol. Its IUPAC name is N-(4-aminobutyl)-2,3,4,5,6-pentamethylbenzenesulfonamide.
| Compound Name | N-(4-aminobutyl)-2,3,4,5,6-pentamethylbenzenesulfonamide |
|---|---|
| PubChem CID | 120583696 |
| Molecular Formula | C15H26N2O2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | N-(4-aminobutyl)-2,3,4,5,6-pentamethylbenzenesulfonamide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)NCCCCN)c(C)c1C |
| InChI | InChI=1S/C15H26N2O2S/c1-10-11(2)13(4)15(14(5)12(10)3)20(18,19)17-9-7-6-8-16/h17H,6-9,16H2,1-5H3 |
| InChIKey | GTJWGIOVDRFOHX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|