C17H24N4O2S — CID 99809501
2,3,4,5,6-pentamethyl-N-[2-(pyrimidin-2-ylamino)ethyl]benzenesulfonamide (PubChem CID 99809501) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is 2,3,4,5,6-pentamethyl-N-[2-(pyrimidin-2-ylamino)ethyl]benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentamethyl-N-[2-(pyrimidin-2-ylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 99809501 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 2,3,4,5,6-pentamethyl-N-[2-(pyrimidin-2-ylamino)ethyl]benzenesulfonamide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)NCCNc2ncccn2)c(C)c1C |
| InChI | InChI=1S/C17H24N4O2S/c1-11-12(2)14(4)16(15(5)13(11)3)24(22,23)21-10-9-20-17-18-7-6-8-19-17/h6-8,21H,9-10H2,1-5H3,(H,18,19,20) |
| InChIKey | QZEUMIKOXUKHOT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|