C20H26N4O2S — CID 55729232
4-tert-butyl-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-2,6-dimethylbenzenesulfonamide (PubChem CID 55729232) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-2,6-dimethylbenzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-2,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 55729232 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 4-tert-butyl-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-2,6-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1S(=O)(=O)NCCNc1ncccc1C#N |
| InChI | InChI=1S/C20H26N4O2S/c1-14-11-17(20(3,4)5)12-15(2)18(14)27(25,26)24-10-9-23-19-16(13-21)7-6-8-22-19/h6-8,11-12,24H,9-10H2,1-5H3,(H,22,23) |
| InChIKey | CIMPBLUJYHIDDD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|