C16H14N6O4S — CID 55905845
N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-2,4-dioxo-1H-quinazoline-6-sulfonamide (PubChem CID 55905845) has the molecular formula C16H14N6O4S and a molecular weight of 386.39 g/mol. Its IUPAC name is N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-2,4-dioxo-1H-quinazoline-6-sulfonamide.
| Compound Name | N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-2,4-dioxo-1H-quinazoline-6-sulfonamide |
|---|---|
| PubChem CID | 55905845 |
| Molecular Formula | C16H14N6O4S |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-2,4-dioxo-1H-quinazoline-6-sulfonamide |
| SMILES | N#Cc1cccnc1NCCNS(=O)(=O)c1ccc2[nH]c(=O)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C16H14N6O4S/c17-9-10-2-1-5-18-14(10)19-6-7-20-27(25,26)11-3-4-13-12(8-11)15(23)22-16(24)21-13/h1-5,8,20H,6-7H2,(H,18,19)(H2,21,22,23,24) |
| InChIKey | BWAAYKZRLLRGIM-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|