C18H20N4O4S — CID 52565588
N-[3-(N-methylanilino)propyl]-2,4-dioxo-1H-quinazoline-6-sulfonamide (PubChem CID 52565588) has the molecular formula C18H20N4O4S and a molecular weight of 388.45 g/mol. Its IUPAC name is N-[3-(N-methylanilino)propyl]-2,4-dioxo-1H-quinazoline-6-sulfonamide.
| Compound Name | N-[3-(N-methylanilino)propyl]-2,4-dioxo-1H-quinazoline-6-sulfonamide |
|---|---|
| PubChem CID | 52565588 |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-[3-(N-methylanilino)propyl]-2,4-dioxo-1H-quinazoline-6-sulfonamide |
| SMILES | CN(CCCNS(=O)(=O)c1ccc2[nH]c(=O)[nH]c(=O)c2c1)c1ccccc1 |
| InChI | InChI=1S/C18H20N4O4S/c1-22(13-6-3-2-4-7-13)11-5-10-19-27(25,26)14-8-9-16-15(12-14)17(23)21-18(24)20-16/h2-4,6-9,12,19H,5,10-11H2,1H3,(H2,20,21,23,24) |
| InChIKey | PZAGQZAPILIZNT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 115.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|