C9H12N4O2S — CID 102675423
2-[(3-cyano-2-pyridinyl)amino]-N-methylethanesulfonamide (PubChem CID 102675423) has the molecular formula C9H12N4O2S and a molecular weight of 240.29 g/mol. Its IUPAC name is 2-[(3-cyano-2-pyridinyl)amino]-N-methylethanesulfonamide.
| Compound Name | 2-[(3-cyano-2-pyridinyl)amino]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 102675423 |
| Molecular Formula | C9H12N4O2S |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 2-[(3-cyano-2-pyridinyl)amino]-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNc1ncccc1C#N |
| InChI | InChI=1S/C9H12N4O2S/c1-11-16(14,15)6-5-13-9-8(7-10)3-2-4-12-9/h2-4,11H,5-6H2,1H3,(H,12,13) |
| InChIKey | ZDPRFXAQDRUXPE-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |