C11H15N3O2S — CID 79563043
2-[(2-methyl-2-methylsulfonylpropyl)amino]pyridine-3-carbonitrile (PubChem CID 79563043) has the molecular formula C11H15N3O2S and a molecular weight of 253.33 g/mol. Its IUPAC name is 2-[(2-methyl-2-methylsulfonylpropyl)amino]pyridine-3-carbonitrile.
| Compound Name | 2-[(2-methyl-2-methylsulfonylpropyl)amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 79563043 |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-[(2-methyl-2-methylsulfonylpropyl)amino]pyridine-3-carbonitrile |
| SMILES | CC(C)(CNc1ncccc1C#N)S(C)(=O)=O |
| InChI | InChI=1S/C11H15N3O2S/c1-11(2,17(3,15)16)8-14-10-9(7-12)5-4-6-13-10/h4-6H,8H2,1-3H3,(H,13,14) |
| InChIKey | SIJAAXKWOCWEQR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |