C11H16N4O2S — CID 82814232
3-amino-2-[(2-methyl-2-methylsulfonylpropyl)amino]pyridine-4-carbonitrile (PubChem CID 82814232) has the molecular formula C11H16N4O2S and a molecular weight of 268.34 g/mol. Its IUPAC name is 3-amino-2-[(2-methyl-2-methylsulfonylpropyl)amino]pyridine-4-carbonitrile.
| Compound Name | 3-amino-2-[(2-methyl-2-methylsulfonylpropyl)amino]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 82814232 |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 3-amino-2-[(2-methyl-2-methylsulfonylpropyl)amino]pyridine-4-carbonitrile |
| SMILES | CC(C)(CNc1nccc(C#N)c1N)S(C)(=O)=O |
| InChI | InChI=1S/C11H16N4O2S/c1-11(2,18(3,16)17)7-15-10-9(13)8(6-12)4-5-14-10/h4-5H,7,13H2,1-3H3,(H,14,15) |
| InChIKey | ITGGKCGUDPTWRX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |