C11H17N5 — CID 82817077
3-amino-2-[2-[ethyl(methyl)amino]ethylamino]pyridine-4-carbonitrile (PubChem CID 82817077) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is 3-amino-2-[2-[ethyl(methyl)amino]ethylamino]pyridine-4-carbonitrile.
| Compound Name | 3-amino-2-[2-[ethyl(methyl)amino]ethylamino]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 82817077 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 3-amino-2-[2-[ethyl(methyl)amino]ethylamino]pyridine-4-carbonitrile |
| SMILES | CCN(C)CCNc1nccc(C#N)c1N |
| InChI | InChI=1S/C11H17N5/c1-3-16(2)7-6-15-11-10(13)9(8-12)4-5-14-11/h4-5H,3,6-7,13H2,1-2H3,(H,14,15) |
| InChIKey | FDJUEPYVDZLKSN-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |