C9H11FN4 — CID 130503947
3-amino-2-(3-fluoropropylamino)pyridine-4-carbonitrile (PubChem CID 130503947) has the molecular formula C9H11FN4 and a molecular weight of 194.21 g/mol. Its IUPAC name is 3-amino-2-(3-fluoropropylamino)pyridine-4-carbonitrile.
| Compound Name | 3-amino-2-(3-fluoropropylamino)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 130503947 |
| Molecular Formula | C9H11FN4 |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | 3-amino-2-(3-fluoropropylamino)pyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(NCCCF)c1N |
| InChI | InChI=1S/C9H11FN4/c10-3-1-4-13-9-8(12)7(6-11)2-5-14-9/h2,5H,1,3-4,12H2,(H,13,14) |
| InChIKey | LFTSCFQBXQCUBG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|