C20H35NO2S — CID 19681388
2,3,4,5,6-pentamethyl-N-nonylbenzenesulfonamide (PubChem CID 19681388) has the molecular formula C20H35NO2S and a molecular weight of 353.57 g/mol. Its IUPAC name is 2,3,4,5,6-pentamethyl-N-nonylbenzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentamethyl-N-nonylbenzenesulfonamide |
|---|---|
| PubChem CID | 19681388 |
| Molecular Formula | C20H35NO2S |
| Molecular Weight | 353.57 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 2,3,4,5,6-pentamethyl-N-nonylbenzenesulfonamide |
| SMILES | CCCCCCCCCNS(=O)(=O)c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C20H35NO2S/c1-7-8-9-10-11-12-13-14-21-24(22,23)20-18(5)16(3)15(2)17(4)19(20)6/h21H,7-14H2,1-6H3 |
| InChIKey | GIRGGXASYSLVRD-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.57 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|