C16H26FNO2S — CID 107327354
4-fluoro-2,6-dimethyl-N-octylbenzenesulfonamide (PubChem CID 107327354) has the molecular formula C16H26FNO2S and a molecular weight of 315.45 g/mol. Its IUPAC name is 4-fluoro-2,6-dimethyl-N-octylbenzenesulfonamide.
| Compound Name | 4-fluoro-2,6-dimethyl-N-octylbenzenesulfonamide |
|---|---|
| PubChem CID | 107327354 |
| Molecular Formula | C16H26FNO2S |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 4-fluoro-2,6-dimethyl-N-octylbenzenesulfonamide |
| SMILES | CCCCCCCCNS(=O)(=O)c1c(C)cc(F)cc1C |
| InChI | InChI=1S/C16H26FNO2S/c1-4-5-6-7-8-9-10-18-21(19,20)16-13(2)11-15(17)12-14(16)3/h11-12,18H,4-10H2,1-3H3 |
| InChIKey | XKAAWSVMXBUVEP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|