C13H19FN2O2S2 — CID 107327675
5-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]pentanethioamide (PubChem CID 107327675) has the molecular formula C13H19FN2O2S2 and a molecular weight of 318.44 g/mol. Its IUPAC name is 5-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]pentanethioamide.
| Compound Name | 5-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]pentanethioamide |
|---|---|
| PubChem CID | 107327675 |
| Molecular Formula | C13H19FN2O2S2 |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 5-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]pentanethioamide |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)NCCCCC(N)=S |
| InChI | InChI=1S/C13H19FN2O2S2/c1-9-7-11(14)8-10(2)13(9)20(17,18)16-6-4-3-5-12(15)19/h7-8,16H,3-6H2,1-2H3,(H2,15,19) |
| InChIKey | SXYOZXTZLWZMTH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|