C10H14FN3O2S — CID 107329498
2-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]ethanimidamide (PubChem CID 107329498) has the molecular formula C10H14FN3O2S and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]ethanimidamide.
| Compound Name | 2-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]ethanimidamide |
|---|---|
| PubChem CID | 107329498 |
| Molecular Formula | C10H14FN3O2S |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]ethanimidamide |
| SMILES | [H]/N=C(\N)CNS(=O)(=O)c1c(C)cc(F)cc1C |
| InChI | InChI=1S/C10H14FN3O2S/c1-6-3-8(11)4-7(2)10(6)17(15,16)14-5-9(12)13/h3-4,14H,5H2,1-2H3,(H3,12,13) |
| InChIKey | LAQZSCGQIVLEJS-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|