C14H23FN2O2S — CID 107328336
N-(2-amino-2-ethylbutyl)-4-fluoro-2,6-dimethylbenzenesulfonamide (PubChem CID 107328336) has the molecular formula C14H23FN2O2S and a molecular weight of 302.42 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-4-fluoro-2,6-dimethylbenzenesulfonamide.
| Compound Name | N-(2-amino-2-ethylbutyl)-4-fluoro-2,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107328336 |
| Molecular Formula | C14H23FN2O2S |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-4-fluoro-2,6-dimethylbenzenesulfonamide |
| SMILES | CCC(N)(CC)CNS(=O)(=O)c1c(C)cc(F)cc1C |
| InChI | InChI=1S/C14H23FN2O2S/c1-5-14(16,6-2)9-17-20(18,19)13-10(3)7-12(15)8-11(13)4/h7-8,17H,5-6,9,16H2,1-4H3 |
| InChIKey | SCJADMQLJNHUPA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |