C14H22FN3O2S — CID 107329503
2-ethyl-2-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]butanimidamide (PubChem CID 107329503) has the molecular formula C14H22FN3O2S and a molecular weight of 315.41 g/mol. Its IUPAC name is 2-ethyl-2-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]butanimidamide.
| Compound Name | 2-ethyl-2-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]butanimidamide |
|---|---|
| PubChem CID | 107329503 |
| Molecular Formula | C14H22FN3O2S |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2-ethyl-2-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]butanimidamide |
| SMILES | [H]/N=C(\N)C(CC)(CC)NS(=O)(=O)c1c(C)cc(F)cc1C |
| InChI | InChI=1S/C14H22FN3O2S/c1-5-14(6-2,13(16)17)18-21(19,20)12-9(3)7-11(15)8-10(12)4/h7-8,18H,5-6H2,1-4H3,(H3,16,17) |
| InChIKey | NPKPPEJXWFNYOS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|