C11H17N3O4S — CID 60895053
N-(4-aminobutyl)-2-methyl-6-nitrobenzenesulfonamide (PubChem CID 60895053) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is N-(4-aminobutyl)-2-methyl-6-nitrobenzenesulfonamide.
| Compound Name | N-(4-aminobutyl)-2-methyl-6-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 60895053 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | N-(4-aminobutyl)-2-methyl-6-nitrobenzenesulfonamide |
| SMILES | Cc1cccc([N+](=O)[O-])c1S(=O)(=O)NCCCCN |
| InChI | InChI=1S/C11H17N3O4S/c1-9-5-4-6-10(14(15)16)11(9)19(17,18)13-8-3-2-7-12/h4-6,13H,2-3,7-8,12H2,1H3 |
| InChIKey | QYMCLYQFBCSNLE-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|