C10H16ClN3O4S — CID 119962275
N-(3-aminopropyl)-2-methyl-6-nitrobenzenesulfonamide;hydrochloride (PubChem CID 119962275) has the molecular formula C10H16ClN3O4S and a molecular weight of 309.77 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-methyl-6-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-2-methyl-6-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119962275 |
| Molecular Formula | C10H16ClN3O4S |
| Molecular Weight | 309.77 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | N-(3-aminopropyl)-2-methyl-6-nitrobenzenesulfonamide;hydrochloride |
| SMILES | Cc1cccc([N+](=O)[O-])c1S(=O)(=O)NCCCN.Cl |
| InChI | InChI=1S/C10H15N3O4S.ClH/c1-8-4-2-5-9(13(14)15)10(8)18(16,17)12-7-3-6-11;/h2,4-5,12H,3,6-7,11H2,1H3;1H |
| InChIKey | ORIDVYXSTTWNMD-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.77 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|