C11H14N2O7S — CID 79469714
2-[2-[(2-methyl-6-nitrophenyl)sulfonylamino]ethoxy]acetic acid (PubChem CID 79469714) has the molecular formula C11H14N2O7S and a molecular weight of 318.31 g/mol. Its IUPAC name is 2-[2-[(2-methyl-6-nitrophenyl)sulfonylamino]ethoxy]acetic acid.
| Compound Name | 2-[2-[(2-methyl-6-nitrophenyl)sulfonylamino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 79469714 |
| Molecular Formula | C11H14N2O7S |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 2-[2-[(2-methyl-6-nitrophenyl)sulfonylamino]ethoxy]acetic acid |
| SMILES | Cc1cccc([N+](=O)[O-])c1S(=O)(=O)NCCOCC(=O)O |
| InChI | InChI=1S/C11H14N2O7S/c1-8-3-2-4-9(13(16)17)11(8)21(18,19)12-5-6-20-7-10(14)15/h2-4,12H,5-7H2,1H3,(H,14,15) |
| InChIKey | RQOMMPOCXZGMKS-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 135.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|