C11H15NO5S — CID 79456829
2-[2-[(3-methylphenyl)sulfonylamino]ethoxy]acetic acid (PubChem CID 79456829) has the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. Its IUPAC name is 2-[2-[(3-methylphenyl)sulfonylamino]ethoxy]acetic acid.
| Compound Name | 2-[2-[(3-methylphenyl)sulfonylamino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 79456829 |
| Molecular Formula | C11H15NO5S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-[2-[(3-methylphenyl)sulfonylamino]ethoxy]acetic acid |
| SMILES | Cc1cccc(S(=O)(=O)NCCOCC(=O)O)c1 |
| InChI | InChI=1S/C11H15NO5S/c1-9-3-2-4-10(7-9)18(15,16)12-5-6-17-8-11(13)14/h2-4,7,12H,5-6,8H2,1H3,(H,13,14) |
| InChIKey | TVXLQTFGLNLHGR-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|