C17H30N2O2S — CID 110758589
4-tert-butyl-N-[3-(dimethylamino)propyl]-2,6-dimethylbenzenesulfonamide (PubChem CID 110758589) has the molecular formula C17H30N2O2S and a molecular weight of 326.51 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-(dimethylamino)propyl]-2,6-dimethylbenzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[3-(dimethylamino)propyl]-2,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 110758589 |
| Molecular Formula | C17H30N2O2S |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 4-tert-butyl-N-[3-(dimethylamino)propyl]-2,6-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1S(=O)(=O)NCCCN(C)C |
| InChI | InChI=1S/C17H30N2O2S/c1-13-11-15(17(3,4)5)12-14(2)16(13)22(20,21)18-9-8-10-19(6)7/h11-12,18H,8-10H2,1-7H3 |
| InChIKey | NVOVPFBRSIGDIU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|