C11H18FN3O2S — CID 113306253
3-amino-N-[2-(dimethylamino)ethyl]-4-fluoro-5-methylbenzenesulfonamide (PubChem CID 113306253) has the molecular formula C11H18FN3O2S and a molecular weight of 275.35 g/mol. Its IUPAC name is 3-amino-N-[2-(dimethylamino)ethyl]-4-fluoro-5-methylbenzenesulfonamide.
| Compound Name | 3-amino-N-[2-(dimethylamino)ethyl]-4-fluoro-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 113306253 |
| Molecular Formula | C11H18FN3O2S |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 3-amino-N-[2-(dimethylamino)ethyl]-4-fluoro-5-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCN(C)C)cc(N)c1F |
| InChI | InChI=1S/C11H18FN3O2S/c1-8-6-9(7-10(13)11(8)12)18(16,17)14-4-5-15(2)3/h6-7,14H,4-5,13H2,1-3H3 |
| InChIKey | IXQFSNXVGXNBFQ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|