C12H16F4N2O2S — CID 115515200
3-amino-4-fluoro-5-methyl-N-(5,5,5-trifluoropentyl)benzenesulfonamide (PubChem CID 115515200) has the molecular formula C12H16F4N2O2S and a molecular weight of 328.33 g/mol. Its IUPAC name is 3-amino-4-fluoro-5-methyl-N-(5,5,5-trifluoropentyl)benzenesulfonamide.
| Compound Name | 3-amino-4-fluoro-5-methyl-N-(5,5,5-trifluoropentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115515200 |
| Molecular Formula | C12H16F4N2O2S |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 3-amino-4-fluoro-5-methyl-N-(5,5,5-trifluoropentyl)benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCCCC(F)(F)F)cc(N)c1F |
| InChI | InChI=1S/C12H16F4N2O2S/c1-8-6-9(7-10(17)11(8)13)21(19,20)18-5-3-2-4-12(14,15)16/h6-7,18H,2-5,17H2,1H3 |
| InChIKey | SAOMOAZVUPSQBI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|