C14H6F8N8O4S2 — CID 58925536
4-azido-N-[2-[(4-azido-2,3,5,6-tetrafluorophenyl)sulfonylamino]ethyl]-2,3,5,6-tetrafluorobenzenesulfonamide (PubChem CID 58925536) has the molecular formula C14H6F8N8O4S2 and a molecular weight of 566.37 g/mol. Its IUPAC name is 4-azido-N-[2-[(4-azido-2,3,5,6-tetrafluorophenyl)sulfonylamino]ethyl]-2,3,5,6-tetrafluorobenzenesulfonamide.
| Compound Name | 4-azido-N-[2-[(4-azido-2,3,5,6-tetrafluorophenyl)sulfonylamino]ethyl]-2,3,5,6-tetrafluorobenzenesulfonamide |
|---|---|
| PubChem CID | 58925536 |
| Molecular Formula | C14H6F8N8O4S2 |
| Molecular Weight | 566.37 g/mol |
| Exact Mass | 565.98 |
| IUPAC Name | 4-azido-N-[2-[(4-azido-2,3,5,6-tetrafluorophenyl)sulfonylamino]ethyl]-2,3,5,6-tetrafluorobenzenesulfonamide |
| SMILES | [N-]=[N+]=Nc1c(F)c(F)c(S(=O)(=O)NCCNS(=O)(=O)c2c(F)c(F)c(N=[N+]=[N-])c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C14H6F8N8O4S2/c15-3-7(19)13(8(20)4(16)11(3)27-29-23)35(31,32)25-1-2-26-36(33,34)14-9(21)5(17)12(28-30-24)6(18)10(14)22/h25-26H,1-2H2 |
| InChIKey | NXOXGUJVOMRDQI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 189.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|