C14H12F4N4O2 — CID 161278811
4-azido-2,3,5,6-tetrafluoro-N-(5-methyl-4-oxohex-5-enyl)benzamide (PubChem CID 161278811) has the molecular formula C14H12F4N4O2 and a molecular weight of 344.27 g/mol. Its IUPAC name is 4-azido-2,3,5,6-tetrafluoro-N-(5-methyl-4-oxohex-5-enyl)benzamide.
| Compound Name | 4-azido-2,3,5,6-tetrafluoro-N-(5-methyl-4-oxohex-5-enyl)benzamide |
|---|---|
| PubChem CID | 161278811 |
| Molecular Formula | C14H12F4N4O2 |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 4-azido-2,3,5,6-tetrafluoro-N-(5-methyl-4-oxohex-5-enyl)benzamide |
| SMILES | C=C(C)C(=O)CCCNC(=O)c1c(F)c(F)c(N=[N+]=[N-])c(F)c1F |
| InChI | InChI=1S/C14H12F4N4O2/c1-6(2)7(23)4-3-5-20-14(24)8-9(15)11(17)13(21-22-19)12(18)10(8)16/h1,3-5H2,2H3,(H,20,24) |
| InChIKey | TVWGMSVOBQNAKR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|