C9H6F4N4O — CID 175094225
2-amino-1-(4-azido-2,3,5,6-tetrafluorophenyl)propan-1-one (PubChem CID 175094225) has the molecular formula C9H6F4N4O and a molecular weight of 262.17 g/mol. Its IUPAC name is 2-amino-1-(4-azido-2,3,5,6-tetrafluorophenyl)propan-1-one.
| Compound Name | 2-amino-1-(4-azido-2,3,5,6-tetrafluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 175094225 |
| Molecular Formula | C9H6F4N4O |
| Molecular Weight | 262.17 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 2-amino-1-(4-azido-2,3,5,6-tetrafluorophenyl)propan-1-one |
| SMILES | CC(N)C(=O)c1c(F)c(F)c(N=[N+]=[N-])c(F)c1F |
| InChI | InChI=1S/C9H6F4N4O/c1-2(14)9(18)3-4(10)6(12)8(16-17-15)7(13)5(3)11/h2H,14H2,1H3 |
| InChIKey | CBRAUKODGKMISW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.17 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|