C8H4F4N2O — CID 57027229
1-(4-amino-2,3,5,6-tetrafluorophenyl)-2-iminoethanone (PubChem CID 57027229) has the molecular formula C8H4F4N2O and a molecular weight of 220.12 g/mol. Its IUPAC name is 1-(4-amino-2,3,5,6-tetrafluorophenyl)-2-iminoethanone.
| Compound Name | 1-(4-amino-2,3,5,6-tetrafluorophenyl)-2-iminoethanone |
|---|---|
| PubChem CID | 57027229 |
| Molecular Formula | C8H4F4N2O |
| Molecular Weight | 220.12 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 1-(4-amino-2,3,5,6-tetrafluorophenyl)-2-iminoethanone |
| SMILES | [H]/N=C/C(=O)c1c(F)c(F)c(N)c(F)c1F |
| InChI | InChI=1S/C8H4F4N2O/c9-4-3(2(15)1-13)5(10)7(12)8(14)6(4)11/h1,13H,14H2/b13-1+ |
| InChIKey | RYKWNLUDCRTTFS-HSIUAXRUSA-N |
| XLogP | 1.66 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.12 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|