methyl 4-azido-2,3,5-trifluoro-6-nitrobenzoate

C8H3F3N4O4 — CID 14642573

IUPACmethyl 4-azido-2,3,5-trifluoro-6-nitrobenzoate
SMILESCOC(=O)c1c(F)c(F)c(N=[N+]=[N-])c(F)c1[N+](=O)[O-]
InChIInChI=1S/C8H3F3N4O4/c1-19-8(16)2-3(9)4(10)6(13-14-12)5(11)7(2)15(17)18/h1H3
InChIKeyAUYWTHQWXTXLMT-UHFFFAOYSA-N
MW276.13 g/mol
LogP2.74
Rot. Bonds3

About methyl 4-azido-2,3,5-trifluoro-6-nitrobenzoate

methyl 4-azido-2,3,5-trifluoro-6-nitrobenzoate (PubChem CID 14642573) has the molecular formula C8H3F3N4O4 and a molecular weight of 276.13 g/mol. Its IUPAC name is methyl 4-azido-2,3,5-trifluoro-6-nitrobenzoate.

Molecular Properties

Compound Namemethyl 4-azido-2,3,5-trifluoro-6-nitrobenzoate
PubChem CID14642573
Molecular FormulaC8H3F3N4O4
Molecular Weight276.13 g/mol
Exact Mass276.01
IUPAC Namemethyl 4-azido-2,3,5-trifluoro-6-nitrobenzoate
SMILESCOC(=O)c1c(F)c(F)c(N=[N+]=[N-])c(F)c1[N+](=O)[O-]
InChIInChI=1S/C8H3F3N4O4/c1-19-8(16)2-3(9)4(10)6(13-14-12)5(11)7(2)15(17)18/h1H3
InChIKeyAUYWTHQWXTXLMT-UHFFFAOYSA-N
XLogP2.74
TPSA118.20 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.13
LogP ≤ 52.74
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}

Analyze methyl 4-azido-2,3,5-trifluoro-6-nitrobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-azido-2,3,5-trifluoro-6-nitrobenzoate?
The IUPAC name of methyl 4-azido-2,3,5-trifluoro-6-nitrobenzoate (CID 14642573) is methyl 4-azido-2,3,5-trifluoro-6-nitrobenzoate.
What is the SMILES notation for methyl 4-azido-2,3,5-trifluoro-6-nitrobenzoate?
The canonical SMILES for methyl 4-azido-2,3,5-trifluoro-6-nitrobenzoate is COC(=O)c1c(F)c(F)c(N=[N+]=[N-])c(F)c1[N+](=O)[O-].
What is the InChIKey of methyl 4-azido-2,3,5-trifluoro-6-nitrobenzoate?
The InChIKey is AUYWTHQWXTXLMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3F3N4O4/c1-19-8(16)2-3(9)4(10)6(13-14-12)5(11)7(2)15(17)18/h1H3.
What are the key properties of methyl 4-azido-2,3,5-trifluoro-6-nitrobenzoate?
methyl 4-azido-2,3,5-trifluoro-6-nitrobenzoate has a molecular weight of 276.13 g/mol, XLogP of 2.74, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-azido-2,3,5-trifluoro-6-nitrobenzoate is sourced from PubChem (CID 14642573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).