C8H3F3N4O4 — CID 14642573
methyl 4-azido-2,3,5-trifluoro-6-nitrobenzoate (PubChem CID 14642573) has the molecular formula C8H3F3N4O4 and a molecular weight of 276.13 g/mol. Its IUPAC name is methyl 4-azido-2,3,5-trifluoro-6-nitrobenzoate.
| Compound Name | methyl 4-azido-2,3,5-trifluoro-6-nitrobenzoate |
|---|---|
| PubChem CID | 14642573 |
| Molecular Formula | C8H3F3N4O4 |
| Molecular Weight | 276.13 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | methyl 4-azido-2,3,5-trifluoro-6-nitrobenzoate |
| SMILES | COC(=O)c1c(F)c(F)c(N=[N+]=[N-])c(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H3F3N4O4/c1-19-8(16)2-3(9)4(10)6(13-14-12)5(11)7(2)15(17)18/h1H3 |
| InChIKey | AUYWTHQWXTXLMT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 118.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.13 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|