C6F4N4O2 — CID 151071541
1-azido-2,3,4,5-tetrafluoro-6-nitrobenzene (PubChem CID 151071541) has the molecular formula C6F4N4O2 and a molecular weight of 236.08 g/mol. Its IUPAC name is 1-azido-2,3,4,5-tetrafluoro-6-nitrobenzene.
| Compound Name | 1-azido-2,3,4,5-tetrafluoro-6-nitrobenzene |
|---|---|
| PubChem CID | 151071541 |
| Molecular Formula | C6F4N4O2 |
| Molecular Weight | 236.08 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | 1-azido-2,3,4,5-tetrafluoro-6-nitrobenzene |
| SMILES | [N-]=[N+]=Nc1c(F)c(F)c(F)c(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C6F4N4O2/c7-1-2(8)4(10)6(14(15)16)5(3(1)9)12-13-11 |
| InChIKey | MIFVMOAPSGRPJM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 91.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.08 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|