C12H14F5NO3Si — CID 90171563
N-[[ethyl(dimethoxy)silyl]methyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 90171563) has the molecular formula C12H14F5NO3Si and a molecular weight of 343.32 g/mol. Its IUPAC name is N-[[ethyl(dimethoxy)silyl]methyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[[ethyl(dimethoxy)silyl]methyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 90171563 |
| Molecular Formula | C12H14F5NO3Si |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | N-[[ethyl(dimethoxy)silyl]methyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | CC[Si](CNC(=O)c1c(F)c(F)c(F)c(F)c1F)(OC)OC |
| InChI | InChI=1S/C12H14F5NO3Si/c1-4-22(20-2,21-3)5-18-12(19)6-7(13)9(15)11(17)10(16)8(6)14/h4-5H2,1-3H3,(H,18,19) |
| InChIKey | JSNHQPQVAVBINR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|