C27H25N3O4 — CID 18625805
3-[4-[2-[(4-pyridin-2-ylbenzoyl)amino]ethoxy]phenyl]-2-pyrrol-1-ylpropanoic acid (PubChem CID 18625805) has the molecular formula C27H25N3O4 and a molecular weight of 455.51 g/mol. Its IUPAC name is 3-[4-[2-[(4-pyridin-2-ylbenzoyl)amino]ethoxy]phenyl]-2-pyrrol-1-ylpropanoic acid.
| Compound Name | 3-[4-[2-[(4-pyridin-2-ylbenzoyl)amino]ethoxy]phenyl]-2-pyrrol-1-ylpropanoic acid |
|---|---|
| PubChem CID | 18625805 |
| Molecular Formula | C27H25N3O4 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 3-[4-[2-[(4-pyridin-2-ylbenzoyl)amino]ethoxy]phenyl]-2-pyrrol-1-ylpropanoic acid |
| SMILES | O=C(NCCOc1ccc(CC(C(=O)O)n2cccc2)cc1)c1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C27H25N3O4/c31-26(22-10-8-21(9-11-22)24-5-1-2-14-28-24)29-15-18-34-23-12-6-20(7-13-23)19-25(27(32)33)30-16-3-4-17-30/h1-14,16-17,25H,15,18-19H2,(H,29,31)(H,32,33) |
| InChIKey | PUMBZDFGFGTXGM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|