C33H41N3O6 — CID 18626036
[[2-methyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]amino] 2-[[4-[2-[(4-pyridin-2-ylbenzoyl)amino]ethoxy]phenyl]methyl]butanoate (PubChem CID 18626036) has the molecular formula C33H41N3O6 and a molecular weight of 575.71 g/mol. Its IUPAC name is [[2-methyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]amino] 2-[[4-[2-[(4-pyridin-2-ylbenzoyl)amino]ethoxy]phenyl]methyl]butanoate.
| Compound Name | [[2-methyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]amino] 2-[[4-[2-[(4-pyridin-2-ylbenzoyl)amino]ethoxy]phenyl]methyl]butanoate |
|---|---|
| PubChem CID | 18626036 |
| Molecular Formula | C33H41N3O6 |
| Molecular Weight | 575.71 g/mol |
| Exact Mass | 575.30 |
| IUPAC Name | [[2-methyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]amino] 2-[[4-[2-[(4-pyridin-2-ylbenzoyl)amino]ethoxy]phenyl]methyl]butanoate |
| SMILES | CCC(Cc1ccc(OCCNC(=O)c2ccc(-c3ccccn3)cc2)cc1)C(=O)ONCC(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H41N3O6/c1-6-25(32(39)42-36-22-23(2)31(38)41-33(3,4)5)21-24-10-16-28(17-11-24)40-20-19-35-30(37)27-14-12-26(13-15-27)29-9-7-8-18-34-29/h7-18,23,25,36H,6,19-22H2,1-5H3,(H,35,37) |
| InChIKey | RAXCGKDTJNMDRK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.71 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|