C35H38N2O4 — CID 18625890
ethyl 2-methyl-5-phenyl-2-[[4-[2-[(4-pyridin-2-ylbenzoyl)amino]ethoxy]phenyl]methyl]pentanoate (PubChem CID 18625890) has the molecular formula C35H38N2O4 and a molecular weight of 550.70 g/mol. Its IUPAC name is ethyl 2-methyl-5-phenyl-2-[[4-[2-[(4-pyridin-2-ylbenzoyl)amino]ethoxy]phenyl]methyl]pentanoate.
| Compound Name | ethyl 2-methyl-5-phenyl-2-[[4-[2-[(4-pyridin-2-ylbenzoyl)amino]ethoxy]phenyl]methyl]pentanoate |
|---|---|
| PubChem CID | 18625890 |
| Molecular Formula | C35H38N2O4 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | ethyl 2-methyl-5-phenyl-2-[[4-[2-[(4-pyridin-2-ylbenzoyl)amino]ethoxy]phenyl]methyl]pentanoate |
| SMILES | CCOC(=O)C(C)(CCCc1ccccc1)Cc1ccc(OCCNC(=O)c2ccc(-c3ccccn3)cc2)cc1 |
| InChI | InChI=1S/C35H38N2O4/c1-3-40-34(39)35(2,22-9-12-27-10-5-4-6-11-27)26-28-14-20-31(21-15-28)41-25-24-37-33(38)30-18-16-29(17-19-30)32-13-7-8-23-36-32/h4-8,10-11,13-21,23H,3,9,12,22,24-26H2,1-2H3,(H,37,38) |
| InChIKey | KNGWGIVCIMUPJH-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|