C31H31N3O4 — CID 18625947
ethyl 2-anilino-3-[4-[2-[(4-pyridin-2-ylbenzoyl)amino]ethoxy]phenyl]propanoate (PubChem CID 18625947) has the molecular formula C31H31N3O4 and a molecular weight of 509.61 g/mol. Its IUPAC name is ethyl 2-anilino-3-[4-[2-[(4-pyridin-2-ylbenzoyl)amino]ethoxy]phenyl]propanoate.
| Compound Name | ethyl 2-anilino-3-[4-[2-[(4-pyridin-2-ylbenzoyl)amino]ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 18625947 |
| Molecular Formula | C31H31N3O4 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | ethyl 2-anilino-3-[4-[2-[(4-pyridin-2-ylbenzoyl)amino]ethoxy]phenyl]propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(OCCNC(=O)c2ccc(-c3ccccn3)cc2)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C31H31N3O4/c1-2-37-31(36)29(34-26-8-4-3-5-9-26)22-23-11-17-27(18-12-23)38-21-20-33-30(35)25-15-13-24(14-16-25)28-10-6-7-19-32-28/h3-19,29,34H,2,20-22H2,1H3,(H,33,35) |
| InChIKey | TWRIEHNADNVESJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|