C33H34N2O4 — CID 57009679
ethyl 2-anilino-3-[4-[2-[1-(4-phenylphenyl)ethenylamino]oxyethoxy]phenyl]propanoate (PubChem CID 57009679) has the molecular formula C33H34N2O4 and a molecular weight of 522.65 g/mol. Its IUPAC name is ethyl 2-anilino-3-[4-[2-[1-(4-phenylphenyl)ethenylamino]oxyethoxy]phenyl]propanoate.
| Compound Name | ethyl 2-anilino-3-[4-[2-[1-(4-phenylphenyl)ethenylamino]oxyethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 57009679 |
| Molecular Formula | C33H34N2O4 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | ethyl 2-anilino-3-[4-[2-[1-(4-phenylphenyl)ethenylamino]oxyethoxy]phenyl]propanoate |
| SMILES | C=C(NOCCOc1ccc(CC(Nc2ccccc2)C(=O)OCC)cc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H34N2O4/c1-3-37-33(36)32(34-30-12-8-5-9-13-30)24-26-14-20-31(21-15-26)38-22-23-39-35-25(2)27-16-18-29(19-17-27)28-10-6-4-7-11-28/h4-21,32,34-35H,2-3,22-24H2,1H3 |
| InChIKey | PLRQHMLDQOFFSD-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|