C31H30N2O5 — CID 90815650
2-(4-methylphenoxy)-3-[4-[2-[1-(4-pyridin-2-ylphenyl)ethenylamino]oxyethoxy]phenyl]propanoic acid (PubChem CID 90815650) has the molecular formula C31H30N2O5 and a molecular weight of 510.59 g/mol. Its IUPAC name is 2-(4-methylphenoxy)-3-[4-[2-[1-(4-pyridin-2-ylphenyl)ethenylamino]oxyethoxy]phenyl]propanoic acid.
| Compound Name | 2-(4-methylphenoxy)-3-[4-[2-[1-(4-pyridin-2-ylphenyl)ethenylamino]oxyethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 90815650 |
| Molecular Formula | C31H30N2O5 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 2-(4-methylphenoxy)-3-[4-[2-[1-(4-pyridin-2-ylphenyl)ethenylamino]oxyethoxy]phenyl]propanoic acid |
| SMILES | C=C(NOCCOc1ccc(CC(Oc2ccc(C)cc2)C(=O)O)cc1)c1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C31H30N2O5/c1-22-6-14-28(15-7-22)38-30(31(34)35)21-24-8-16-27(17-9-24)36-19-20-37-33-23(2)25-10-12-26(13-11-25)29-5-3-4-18-32-29/h3-18,30,33H,2,19-21H2,1H3,(H,34,35) |
| InChIKey | PWSNHEYEMPAPTQ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|