C34H36N2O5 — CID 72749227
2-(4-tert-butylphenoxy)-3-[4-[2-[1-(4-pyridin-2-ylphenyl)ethylideneamino]oxyethoxy]phenyl]propanoic acid (PubChem CID 72749227) has the molecular formula C34H36N2O5 and a molecular weight of 552.67 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-3-[4-[2-[1-(4-pyridin-2-ylphenyl)ethylideneamino]oxyethoxy]phenyl]propanoic acid.
| Compound Name | 2-(4-tert-butylphenoxy)-3-[4-[2-[1-(4-pyridin-2-ylphenyl)ethylideneamino]oxyethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 72749227 |
| Molecular Formula | C34H36N2O5 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-3-[4-[2-[1-(4-pyridin-2-ylphenyl)ethylideneamino]oxyethoxy]phenyl]propanoic acid |
| SMILES | CC(=NOCCOc1ccc(CC(Oc2ccc(C(C)(C)C)cc2)C(=O)O)cc1)c1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C34H36N2O5/c1-24(26-10-12-27(13-11-26)31-7-5-6-20-35-31)36-40-22-21-39-29-16-8-25(9-17-29)23-32(33(37)38)41-30-18-14-28(15-19-30)34(2,3)4/h5-20,32H,21-23H2,1-4H3,(H,37,38) |
| InChIKey | JRHZDGGCMACSIU-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|