C26H29N3O4 — CID 57067987
2-(ethylamino)-3-[4-[2-[1-(4-pyridin-2-ylphenyl)ethenylamino]oxyethoxy]phenyl]propanoic acid (PubChem CID 57067987) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is 2-(ethylamino)-3-[4-[2-[1-(4-pyridin-2-ylphenyl)ethenylamino]oxyethoxy]phenyl]propanoic acid.
| Compound Name | 2-(ethylamino)-3-[4-[2-[1-(4-pyridin-2-ylphenyl)ethenylamino]oxyethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 57067987 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 2-(ethylamino)-3-[4-[2-[1-(4-pyridin-2-ylphenyl)ethenylamino]oxyethoxy]phenyl]propanoic acid |
| SMILES | C=C(NOCCOc1ccc(CC(NCC)C(=O)O)cc1)c1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C26H29N3O4/c1-3-27-25(26(30)31)18-20-7-13-23(14-8-20)32-16-17-33-29-19(2)21-9-11-22(12-10-21)24-6-4-5-15-28-24/h4-15,25,27,29H,2-3,16-18H2,1H3,(H,30,31) |
| InChIKey | GDPVFAHXVJLUQC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|